C11H15FO7 — CID 67701225
1-[(2S,3R,4S,5R)-4,5-diacetyl-2-(fluoromethyl)-3,4,5-trihydroxyoxolan-3-yl]ethanone (PubChem CID 67701225) has the molecular formula C11H15FO7 and a molecular weight of 278.23 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5R)-4,5-diacetyl-2-(fluoromethyl)-3,4,5-trihydroxyoxolan-3-yl]ethanone.
| Compound Name | 1-[(2S,3R,4S,5R)-4,5-diacetyl-2-(fluoromethyl)-3,4,5-trihydroxyoxolan-3-yl]ethanone |
|---|---|
| PubChem CID | 67701225 |
| Molecular Formula | C11H15FO7 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 1-[(2S,3R,4S,5R)-4,5-diacetyl-2-(fluoromethyl)-3,4,5-trihydroxyoxolan-3-yl]ethanone |
| SMILES | CC(=O)[C@]1(O)[C@](O)(C(C)=O)O[C@H](CF)[C@]1(O)C(C)=O |
| InChI | InChI=1S/C11H15FO7/c1-5(13)9(16)8(4-12)19-11(18,7(3)15)10(9,17)6(2)14/h8,16-18H,4H2,1-3H3/t8-,9-,10-,11+/m1/s1 |
| InChIKey | CICDVXVVZHVEFL-DBIOUOCHSA-N |
| XLogP | -1.73 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |