C37H46N4O3Si — CID 67701267
7-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-bis(phenylmethoxy)pentyl]-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 67701267) has the molecular formula C37H46N4O3Si and a molecular weight of 622.89 g/mol. Its IUPAC name is 7-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-bis(phenylmethoxy)pentyl]-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-bis(phenylmethoxy)pentyl]-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 67701267 |
| Molecular Formula | C37H46N4O3Si |
| Molecular Weight | 622.89 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | 7-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-bis(phenylmethoxy)pentyl]-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC(COCc1ccccc1)C(CCn1cc(-c2ccccc2)c2c(N)ncnc21)OCc1ccccc1 |
| InChI | InChI=1S/C37H46N4O3Si/c1-37(2,3)45(4,5)44-33(26-42-24-28-15-9-6-10-16-28)32(43-25-29-17-11-7-12-18-29)21-22-41-23-31(30-19-13-8-14-20-30)34-35(38)39-27-40-36(34)41/h6-20,23,27,32-33H,21-22,24-26H2,1-5H3,(H2,38,39,40) |
| InChIKey | AFLMCMJULQHDAA-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.89 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|