6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid

C9H11FO2 — CID 67701625

IUPAC6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid
SMILESCCC1(F)C=CC=CC1C(=O)O
InChIInChI=1S/C9H11FO2/c1-2-9(10)6-4-3-5-7(9)8(11)12/h3-7H,2H2,1H3,(H,11,12)
InChIKeySPVPKLQLPVHBIJ-UHFFFAOYSA-N
MW170.18 g/mol
LogP1.93
Rot. Bonds2

About 6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid

6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 67701625) has the molecular formula C9H11FO2 and a molecular weight of 170.18 g/mol. Its IUPAC name is 6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid.

Molecular Properties

Compound Name6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid
PubChem CID67701625
Molecular FormulaC9H11FO2
Molecular Weight170.18 g/mol
Exact Mass170.07
IUPAC Name6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid
SMILESCCC1(F)C=CC=CC1C(=O)O
InChIInChI=1S/C9H11FO2/c1-2-9(10)6-4-3-5-7(9)8(11)12/h3-7H,2H2,1H3,(H,11,12)
InChIKeySPVPKLQLPVHBIJ-UHFFFAOYSA-N
XLogP1.93
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.18
LogP ≤ 51.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid (CID 67701625) is 6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid is CCC1(F)C=CC=CC1C(=O)O.
What is the InChIKey of 6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is SPVPKLQLPVHBIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FO2/c1-2-9(10)6-4-3-5-7(9)8(11)12/h3-7H,2H2,1H3,(H,11,12).
What are the key properties of 6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid?
6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 170.18 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-6-fluorocyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 67701625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).