About 1-ethenyl-2-methyl-4,5-dihydroimidazole;2-methyl-4,5-dihydro-1H-imidazole
1-ethenyl-2-methyl-4,5-dihydroimidazole;2-methyl-4,5-dihydro-1H-imidazole (PubChem CID 67701861) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-ethenyl-2-methyl-4,5-dihydroimidazole;2-methyl-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 1-ethenyl-2-methyl-4,5-dihydroimidazole;2-methyl-4,5-dihydro-1H-imidazole |
| PubChem CID | 67701861 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-ethenyl-2-methyl-4,5-dihydroimidazole;2-methyl-4,5-dihydro-1H-imidazole |
| SMILES | C=CN1CCN=C1C.CC1=NCCN1 |
| InChI | InChI=1S/C6H10N2.C4H8N2/c1-3-8-5-4-7-6(8)2;1-4-5-2-3-6-4/h3H,1,4-5H2,2H3;2-3H2,1H3,(H,5,6) |
| InChIKey | FKZMBDKTVGDRIV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethenyl-2-methyl-4,5-dihydroimidazole;2-methyl-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2-methyl-4,5-dihydroimidazole;2-methyl-4,5-dihydro-1H-imidazole?
The IUPAC name of 1-ethenyl-2-methyl-4,5-dihydroimidazole;2-methyl-4,5-dihydro-1H-imidazole (CID 67701861) is 1-ethenyl-2-methyl-4,5-dihydroimidazole;2-methyl-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 1-ethenyl-2-methyl-4,5-dihydroimidazole;2-methyl-4,5-dihydro-1H-imidazole?
The canonical SMILES for 1-ethenyl-2-methyl-4,5-dihydroimidazole;2-methyl-4,5-dihydro-1H-imidazole is C=CN1CCN=C1C.CC1=NCCN1.
What is the InChIKey of 1-ethenyl-2-methyl-4,5-dihydroimidazole;2-methyl-4,5-dihydro-1H-imidazole?
The InChIKey is FKZMBDKTVGDRIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.C4H8N2/c1-3-8-5-4-7-6(8)2;1-4-5-2-3-6-4/h3H,1,4-5H2,2H3;2-3H2,1H3,(H,5,6).
What are the key properties of 1-ethenyl-2-methyl-4,5-dihydroimidazole;2-methyl-4,5-dihydro-1H-imidazole?
1-ethenyl-2-methyl-4,5-dihydroimidazole;2-methyl-4,5-dihydro-1H-imidazole has a molecular weight of 194.28 g/mol, XLogP of 0.87, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-methyl-4,5-dihydroimidazole;2-methyl-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 67701861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).