C16H16FN3O2 — CID 67702038
1-cyclopropyl-3-[4-fluoro-2-[2-(1,2,4-triazol-1-yl)ethyl]phenyl]propane-1,3-dione (PubChem CID 67702038) has the molecular formula C16H16FN3O2 and a molecular weight of 301.32 g/mol. Its IUPAC name is 1-cyclopropyl-3-[4-fluoro-2-[2-(1,2,4-triazol-1-yl)ethyl]phenyl]propane-1,3-dione.
| Compound Name | 1-cyclopropyl-3-[4-fluoro-2-[2-(1,2,4-triazol-1-yl)ethyl]phenyl]propane-1,3-dione |
|---|---|
| PubChem CID | 67702038 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-cyclopropyl-3-[4-fluoro-2-[2-(1,2,4-triazol-1-yl)ethyl]phenyl]propane-1,3-dione |
| SMILES | O=C(CC(=O)C1CC1)c1ccc(F)cc1CCn1cncn1 |
| InChI | InChI=1S/C16H16FN3O2/c17-13-3-4-14(16(22)8-15(21)11-1-2-11)12(7-13)5-6-20-10-18-9-19-20/h3-4,7,9-11H,1-2,5-6,8H2 |
| InChIKey | RXTZQDBCSOHESS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|