C25H30Cl2N6O5S — CID 67702435
1-[3-acetyl-2-chloro-9-[(2R,5S)-5-(chloromethyl)-3,4-dihydroxyoxolan-2-yl]-6-[(4-phenylsulfanylpiperidin-1-yl)amino]purin-2-yl]ethanone (PubChem CID 67702435) has the molecular formula C25H30Cl2N6O5S and a molecular weight of 597.53 g/mol. Its IUPAC name is 1-[3-acetyl-2-chloro-9-[(2R,5S)-5-(chloromethyl)-3,4-dihydroxyoxolan-2-yl]-6-[(4-phenylsulfanylpiperidin-1-yl)amino]purin-2-yl]ethanone.
| Compound Name | 1-[3-acetyl-2-chloro-9-[(2R,5S)-5-(chloromethyl)-3,4-dihydroxyoxolan-2-yl]-6-[(4-phenylsulfanylpiperidin-1-yl)amino]purin-2-yl]ethanone |
|---|---|
| PubChem CID | 67702435 |
| Molecular Formula | C25H30Cl2N6O5S |
| Molecular Weight | 597.53 g/mol |
| Exact Mass | 596.14 |
| IUPAC Name | 1-[3-acetyl-2-chloro-9-[(2R,5S)-5-(chloromethyl)-3,4-dihydroxyoxolan-2-yl]-6-[(4-phenylsulfanylpiperidin-1-yl)amino]purin-2-yl]ethanone |
| SMILES | CC(=O)N1c2c(ncn2[C@@H]2O[C@H](CCl)C(O)C2O)C(NN2CCC(Sc3ccccc3)CC2)=NC1(Cl)C(C)=O |
| InChI | InChI=1S/C25H30Cl2N6O5S/c1-14(34)25(27)29-22(30-31-10-8-17(9-11-31)39-16-6-4-3-5-7-16)19-23(33(25)15(2)35)32(13-28-19)24-21(37)20(36)18(12-26)38-24/h3-7,13,17-18,20-21,24,36-37H,8-12H2,1-2H3,(H,29,30)/t18-,20?,21?,24-,25?/m1/s1 |
| InChIKey | YWUAEWMQYPKZCF-UGAYMCPLSA-N |
| XLogP | 2.10 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.53 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|