C15H23N3O4S — CID 67702849
2-[[(1S,2S)-1,2-diaminocyclohexyl]-(4-methylphenyl)sulfonylamino]acetic acid (PubChem CID 67702849) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-[[(1S,2S)-1,2-diaminocyclohexyl]-(4-methylphenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[[(1S,2S)-1,2-diaminocyclohexyl]-(4-methylphenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 67702849 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-[[(1S,2S)-1,2-diaminocyclohexyl]-(4-methylphenyl)sulfonylamino]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)O)[C@@]2(N)CCCC[C@@H]2N)cc1 |
| InChI | InChI=1S/C15H23N3O4S/c1-11-5-7-12(8-6-11)23(21,22)18(10-14(19)20)15(17)9-3-2-4-13(15)16/h5-8,13H,2-4,9-10,16-17H2,1H3,(H,19,20)/t13-,15-/m0/s1 |
| InChIKey | IYRVONMVYJQART-ZFWWWQNUSA-N |
| XLogP | 0.63 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|