C21H34F2O4 — CID 67703163
(Z)-7-[(1R,2S,3R)-2-[(4R)-5,5-difluoro-4-hydroxyoctyl]-3-methyl-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 67703163) has the molecular formula C21H34F2O4 and a molecular weight of 388.50 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,3R)-2-[(4R)-5,5-difluoro-4-hydroxyoctyl]-3-methyl-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,3R)-2-[(4R)-5,5-difluoro-4-hydroxyoctyl]-3-methyl-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67703163 |
| Molecular Formula | C21H34F2O4 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | (Z)-7-[(1R,2S,3R)-2-[(4R)-5,5-difluoro-4-hydroxyoctyl]-3-methyl-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCC(F)(F)[C@H](O)CCC[C@H]1[C@H](C)CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C21H34F2O4/c1-3-13-21(22,23)19(25)11-8-10-16-15(2)14-18(24)17(16)9-6-4-5-7-12-20(26)27/h4,6,15-17,19,25H,3,5,7-14H2,1-2H3,(H,26,27)/b6-4-/t15-,16+,17-,19-/m1/s1 |
| InChIKey | ORUIKKYNVXIBIR-MKZMECPCSA-N |
| XLogP | 5.00 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|