C27H48F2O4Si — CID 67703177
(Z)-7-[(1R,2R,3R)-2-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-3-methyl-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 67703177) has the molecular formula C27H48F2O4Si and a molecular weight of 502.76 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R)-2-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-3-methyl-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R)-2-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-3-methyl-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67703177 |
| Molecular Formula | C27H48F2O4Si |
| Molecular Weight | 502.76 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | (Z)-7-[(1R,2R,3R)-2-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-3-methyl-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCC(F)(F)[C@H](CCC[C@@H]1[C@H](C)CC(=O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H48F2O4Si/c1-8-18-27(28,29)24(33-34(6,7)26(3,4)5)16-13-15-21-20(2)19-23(30)22(21)14-11-9-10-12-17-25(31)32/h9,11,20-22,24H,8,10,12-19H2,1-7H3,(H,31,32)/b11-9-/t20-,21-,22-,24+/m1/s1 |
| InChIKey | AVAGFGAQUMGQTG-VVVDFFIUSA-N |
| XLogP | 8.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.76 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|