C26H44F2O4Si — CID 67703190
(Z)-7-[(1R,2R)-2-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid (PubChem CID 67703190) has the molecular formula C26H44F2O4Si and a molecular weight of 486.72 g/mol. Its IUPAC name is (Z)-7-[(1R,2R)-2-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R)-2-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67703190 |
| Molecular Formula | C26H44F2O4Si |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | (Z)-7-[(1R,2R)-2-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
| SMILES | CCCC(F)(F)[C@@H](CCC[C@@H]1C=CC(=O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H44F2O4Si/c1-7-19-26(27,28)23(32-33(5,6)25(2,3)4)15-12-13-20-17-18-22(29)21(20)14-10-8-9-11-16-24(30)31/h8,10,17-18,20-21,23H,7,9,11-16,19H2,1-6H3,(H,30,31)/b10-8-/t20-,21-,23-/m1/s1 |
| InChIKey | DOBYLBRUGWFCAI-RBMBCGQASA-N |
| XLogP | 7.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|