C26H48F2O5Si — CID 67703200
(Z)-7-[(1R,2R,3R,5R)-2-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid (PubChem CID 67703200) has the molecular formula C26H48F2O5Si and a molecular weight of 506.75 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5R)-2-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5R)-2-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67703200 |
| Molecular Formula | C26H48F2O5Si |
| Molecular Weight | 506.75 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5R)-2-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
| SMILES | CCCC(F)(F)[C@H](CCC[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@H](O)C[C@H]1O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48F2O5Si/c1-7-17-26(27,28)23(33-34(5,6)25(2,3)4)15-12-14-20-19(21(29)18-22(20)30)13-10-8-9-11-16-24(31)32/h8,10,19-23,29-30H,7,9,11-18H2,1-6H3,(H,31,32)/b10-8-/t19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | ZTNVOOCXWDIXSU-ZOWYWMAISA-N |
| XLogP | 6.54 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.75 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|