C26H50F2O5Si — CID 67703204
7-[(1R,2R,3R,5S)-2-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 67703204) has the molecular formula C26H50F2O5Si and a molecular weight of 508.76 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 67703204 |
| Molecular Formula | C26H50F2O5Si |
| Molecular Weight | 508.76 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | CCCC(F)(F)[C@@H](CCC[C@@H]1[C@@H](CCCCCCC(=O)O)[C@@H](O)C[C@H]1O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50F2O5Si/c1-7-17-26(27,28)23(33-34(5,6)25(2,3)4)15-12-14-20-19(21(29)18-22(20)30)13-10-8-9-11-16-24(31)32/h19-23,29-30H,7-18H2,1-6H3,(H,31,32)/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | BDIAIYCFJDGMHR-XNBWIAOKSA-N |
| XLogP | 6.77 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.76 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|