About 3-pyridin-1-ium-1-yl-7H-thieno[3,2-c]diazepine
3-pyridin-1-ium-1-yl-7H-thieno[3,2-c]diazepine (PubChem CID 67703617) has the molecular formula C12H10N3S+
and a molecular weight of 228.30 g/mol. Its IUPAC name is 3-pyridin-1-ium-1-yl-7H-thieno[3,2-c]diazepine.
Molecular Properties
| Compound Name | 3-pyridin-1-ium-1-yl-7H-thieno[3,2-c]diazepine |
| PubChem CID | 67703617 |
| Molecular Formula | C12H10N3S+ |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 3-pyridin-1-ium-1-yl-7H-thieno[3,2-c]diazepine |
| SMILES | C1=C2N=NC([n+]3ccccc3)=CC=C2SC1 |
| InChI | InChI=1S/C12H10N3S/c1-2-7-15(8-3-1)12-5-4-11-10(13-14-12)6-9-16-11/h1-8H,9H2/q+1 |
| InChIKey | JDEVLLZDUGRWSM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-pyridin-1-ium-1-yl-7H-thieno[3,2-c]diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-1-ium-1-yl-7H-thieno[3,2-c]diazepine?
The IUPAC name of 3-pyridin-1-ium-1-yl-7H-thieno[3,2-c]diazepine (CID 67703617) is 3-pyridin-1-ium-1-yl-7H-thieno[3,2-c]diazepine.
What is the SMILES notation for 3-pyridin-1-ium-1-yl-7H-thieno[3,2-c]diazepine?
The canonical SMILES for 3-pyridin-1-ium-1-yl-7H-thieno[3,2-c]diazepine is C1=C2N=NC([n+]3ccccc3)=CC=C2SC1.
What is the InChIKey of 3-pyridin-1-ium-1-yl-7H-thieno[3,2-c]diazepine?
The InChIKey is JDEVLLZDUGRWSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N3S/c1-2-7-15(8-3-1)12-5-4-11-10(13-14-12)6-9-16-11/h1-8H,9H2/q+1.
What are the key properties of 3-pyridin-1-ium-1-yl-7H-thieno[3,2-c]diazepine?
3-pyridin-1-ium-1-yl-7H-thieno[3,2-c]diazepine has a molecular weight of 228.30 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-1-ium-1-yl-7H-thieno[3,2-c]diazepine is sourced from PubChem (CID 67703617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).