C14H22N6O4 — CID 67703673
(2S)-2-amino-3-(3-methylimidazol-4-yl)propanoic acid (PubChem CID 67703673) has the molecular formula C14H22N6O4 and a molecular weight of 338.37 g/mol. Its IUPAC name is (2S)-2-amino-3-(3-methylimidazol-4-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(3-methylimidazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 67703673 |
| Molecular Formula | C14H22N6O4 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (2S)-2-amino-3-(3-methylimidazol-4-yl)propanoic acid |
| SMILES | Cn1cncc1C[C@H](N)C(=O)O.Cn1cncc1C[C@H](N)C(=O)O |
| InChI | InChI=1S/2C7H11N3O2/c2*1-10-4-9-3-5(10)2-6(8)7(11)12/h2*3-4,6H,2,8H2,1H3,(H,11,12)/t2*6-/m00/s1 |
| InChIKey | CFVKQEWFDZRKFT-HKGPVOKGSA-N |
| XLogP | -1.25 |
| TPSA | 162.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |