C23H39NO3 — CID 67703832
7-[(1R,2R,5R)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopent-3-en-1-yl]-N-propan-2-ylhept-5-enamide (PubChem CID 67703832) has the molecular formula C23H39NO3 and a molecular weight of 377.57 g/mol. Its IUPAC name is 7-[(1R,2R,5R)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopent-3-en-1-yl]-N-propan-2-ylhept-5-enamide.
| Compound Name | 7-[(1R,2R,5R)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopent-3-en-1-yl]-N-propan-2-ylhept-5-enamide |
|---|---|
| PubChem CID | 67703832 |
| Molecular Formula | C23H39NO3 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | 7-[(1R,2R,5R)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopent-3-en-1-yl]-N-propan-2-ylhept-5-enamide |
| SMILES | CC(C)NC(=O)CCCC=CC[C@@H]1[C@H](C=CCCCCCCO)C=C[C@H]1O |
| InChI | InChI=1S/C23H39NO3/c1-19(2)24-23(27)15-11-7-6-10-14-21-20(16-17-22(21)26)13-9-5-3-4-8-12-18-25/h6,9-10,13,16-17,19-22,25-26H,3-5,7-8,11-12,14-15,18H2,1-2H3,(H,24,27)/t20-,21-,22-/m1/s1 |
| InChIKey | XFBVLTFZNUIUDA-YPAWHYETSA-N |
| XLogP | 4.29 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|