C19H23N3O8 — CID 67704180
[(3aR,8bS)-3,4,8b-trimethyl-5-nitro-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] acetate;(E)-but-2-enedioic acid (PubChem CID 67704180) has the molecular formula C19H23N3O8 and a molecular weight of 421.41 g/mol. Its IUPAC name is [(3aR,8bS)-3,4,8b-trimethyl-5-nitro-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] acetate;(E)-but-2-enedioic acid.
| Compound Name | [(3aR,8bS)-3,4,8b-trimethyl-5-nitro-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] acetate;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 67704180 |
| Molecular Formula | C19H23N3O8 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | [(3aR,8bS)-3,4,8b-trimethyl-5-nitro-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] acetate;(E)-but-2-enedioic acid |
| SMILES | CC(=O)Oc1cc([N+](=O)[O-])c2c(c1)[C@]1(C)CCN(C)[C@@H]1N2C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H19N3O4.C4H4O4/c1-9(19)22-10-7-11-13(12(8-10)18(20)21)17(4)14-15(11,2)5-6-16(14)3;5-3(6)1-2-4(7)8/h7-8,14H,5-6H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t14-,15+;/m1./s1 |
| InChIKey | QHOQLVTZHCFNNY-YWNVCFPDSA-N |
| XLogP | 1.60 |
| TPSA | 150.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|