About 2-(1H-pyrrol-3-yl)isoindole-1,3-dione;hydrochloride
2-(1H-pyrrol-3-yl)isoindole-1,3-dione;hydrochloride (PubChem CID 67704289) has the molecular formula C12H9ClN2O2
and a molecular weight of 248.67 g/mol. Its IUPAC name is 2-(1H-pyrrol-3-yl)isoindole-1,3-dione;hydrochloride.
Molecular Properties
| Compound Name | 2-(1H-pyrrol-3-yl)isoindole-1,3-dione;hydrochloride |
| PubChem CID | 67704289 |
| Molecular Formula | C12H9ClN2O2 |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 2-(1H-pyrrol-3-yl)isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1c2ccccc2C(=O)N1c1cc[nH]c1 |
| InChI | InChI=1S/C12H8N2O2.ClH/c15-11-9-3-1-2-4-10(9)12(16)14(11)8-5-6-13-7-8;/h1-7,13H;1H |
| InChIKey | NDLCYTBMKJLVPP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1H-pyrrol-3-yl)isoindole-1,3-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrrol-3-yl)isoindole-1,3-dione;hydrochloride?
The IUPAC name of 2-(1H-pyrrol-3-yl)isoindole-1,3-dione;hydrochloride (CID 67704289) is 2-(1H-pyrrol-3-yl)isoindole-1,3-dione;hydrochloride.
What is the SMILES notation for 2-(1H-pyrrol-3-yl)isoindole-1,3-dione;hydrochloride?
The canonical SMILES for 2-(1H-pyrrol-3-yl)isoindole-1,3-dione;hydrochloride is Cl.O=C1c2ccccc2C(=O)N1c1cc[nH]c1.
What is the InChIKey of 2-(1H-pyrrol-3-yl)isoindole-1,3-dione;hydrochloride?
The InChIKey is NDLCYTBMKJLVPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2.ClH/c15-11-9-3-1-2-4-10(9)12(16)14(11)8-5-6-13-7-8;/h1-7,13H;1H.
What are the key properties of 2-(1H-pyrrol-3-yl)isoindole-1,3-dione;hydrochloride?
2-(1H-pyrrol-3-yl)isoindole-1,3-dione;hydrochloride has a molecular weight of 248.67 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrrol-3-yl)isoindole-1,3-dione;hydrochloride is sourced from PubChem (CID 67704289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).