C23H31N3O3 — CID 67704305
2-[4-(2-methoxyphenyl)piperazin-1-yl]-N,N-dimethyl-3-propoxybenzamide (PubChem CID 67704305) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N,N-dimethyl-3-propoxybenzamide.
| Compound Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N,N-dimethyl-3-propoxybenzamide |
|---|---|
| PubChem CID | 67704305 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N,N-dimethyl-3-propoxybenzamide |
| SMILES | CCCOc1cccc(C(=O)N(C)C)c1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C23H31N3O3/c1-5-17-29-21-12-8-9-18(23(27)24(2)3)22(21)26-15-13-25(14-16-26)19-10-6-7-11-20(19)28-4/h6-12H,5,13-17H2,1-4H3 |
| InChIKey | JLUGLNSYHNGUMX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |