C11H19IO5 — CID 67704595
(2S,3R,4R,5R)-2-(iodomethyl)-4,5-dimethoxy-3-prop-1-en-2-yloxyoxan-2-ol (PubChem CID 67704595) has the molecular formula C11H19IO5 and a molecular weight of 358.17 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-(iodomethyl)-4,5-dimethoxy-3-prop-1-en-2-yloxyoxan-2-ol.
| Compound Name | (2S,3R,4R,5R)-2-(iodomethyl)-4,5-dimethoxy-3-prop-1-en-2-yloxyoxan-2-ol |
|---|---|
| PubChem CID | 67704595 |
| Molecular Formula | C11H19IO5 |
| Molecular Weight | 358.17 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | (2S,3R,4R,5R)-2-(iodomethyl)-4,5-dimethoxy-3-prop-1-en-2-yloxyoxan-2-ol |
| SMILES | C=C(C)O[C@@H]1[C@H](OC)[C@H](OC)CO[C@]1(O)CI |
| InChI | InChI=1S/C11H19IO5/c1-7(2)17-10-9(15-4)8(14-3)5-16-11(10,13)6-12/h8-10,13H,1,5-6H2,2-4H3/t8-,9-,10-,11-/m1/s1 |
| InChIKey | OMRCNTAIXUFLAV-GWOFURMSSA-N |
| XLogP | 1.09 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|