About 2-(3,3-dimethylcyclohexa-1,5-dien-1-yl)-2-methylpropan-1-amine
2-(3,3-dimethylcyclohexa-1,5-dien-1-yl)-2-methylpropan-1-amine (PubChem CID 67704880) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 2-(3,3-dimethylcyclohexa-1,5-dien-1-yl)-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | 2-(3,3-dimethylcyclohexa-1,5-dien-1-yl)-2-methylpropan-1-amine |
| PubChem CID | 67704880 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 2-(3,3-dimethylcyclohexa-1,5-dien-1-yl)-2-methylpropan-1-amine |
| SMILES | CC1(C)C=C(C(C)(C)CN)C=CC1 |
| InChI | InChI=1S/C12H21N/c1-11(2)7-5-6-10(8-11)12(3,4)9-13/h5-6,8H,7,9,13H2,1-4H3 |
| InChIKey | XVPCOCMEMKQGEO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,3-dimethylcyclohexa-1,5-dien-1-yl)-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethylcyclohexa-1,5-dien-1-yl)-2-methylpropan-1-amine?
The IUPAC name of 2-(3,3-dimethylcyclohexa-1,5-dien-1-yl)-2-methylpropan-1-amine (CID 67704880) is 2-(3,3-dimethylcyclohexa-1,5-dien-1-yl)-2-methylpropan-1-amine.
What is the SMILES notation for 2-(3,3-dimethylcyclohexa-1,5-dien-1-yl)-2-methylpropan-1-amine?
The canonical SMILES for 2-(3,3-dimethylcyclohexa-1,5-dien-1-yl)-2-methylpropan-1-amine is CC1(C)C=C(C(C)(C)CN)C=CC1.
What is the InChIKey of 2-(3,3-dimethylcyclohexa-1,5-dien-1-yl)-2-methylpropan-1-amine?
The InChIKey is XVPCOCMEMKQGEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-11(2)7-5-6-10(8-11)12(3,4)9-13/h5-6,8H,7,9,13H2,1-4H3.
What are the key properties of 2-(3,3-dimethylcyclohexa-1,5-dien-1-yl)-2-methylpropan-1-amine?
2-(3,3-dimethylcyclohexa-1,5-dien-1-yl)-2-methylpropan-1-amine has a molecular weight of 179.31 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethylcyclohexa-1,5-dien-1-yl)-2-methylpropan-1-amine is sourced from PubChem (CID 67704880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).