About [5-[2-[[2-(4-chlorophenyl)-2-phenylethenyl]sulfonylamino]ethyl]naphthalen-1-yl] 2-hydroxyacetate
[5-[2-[[2-(4-chlorophenyl)-2-phenylethenyl]sulfonylamino]ethyl]naphthalen-1-yl] 2-hydroxyacetate (PubChem CID 67704886) has the molecular formula C28H24ClNO5S
and a molecular weight of 522.02 g/mol. Its IUPAC name is [5-[2-[[2-(4-chlorophenyl)-2-phenylethenyl]sulfonylamino]ethyl]naphthalen-1-yl] 2-hydroxyacetate.
Molecular Properties
| Compound Name | [5-[2-[[2-(4-chlorophenyl)-2-phenylethenyl]sulfonylamino]ethyl]naphthalen-1-yl] 2-hydroxyacetate |
| PubChem CID | 67704886 |
| Molecular Formula | C28H24ClNO5S |
| Molecular Weight | 522.02 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | [5-[2-[[2-(4-chlorophenyl)-2-phenylethenyl]sulfonylamino]ethyl]naphthalen-1-yl] 2-hydroxyacetate |
| SMILES | O=C(CO)Oc1cccc2c(CCNS(=O)(=O)C=C(c3ccccc3)c3ccc(Cl)cc3)cccc12 |
| InChI | InChI=1S/C28H24ClNO5S/c29-23-14-12-22(13-15-23)26(20-6-2-1-3-7-20)19-36(33,34)30-17-16-21-8-4-10-25-24(21)9-5-11-27(25)35-28(32)18-31/h1-15,19,30-31H,16-18H2 |
| InChIKey | XWIBXRCHRFLXBK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 522.02 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [5-[2-[[2-(4-chlorophenyl)-2-phenylethenyl]sulfonylamino]ethyl]naphthalen-1-yl] 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[2-[[2-(4-chlorophenyl)-2-phenylethenyl]sulfonylamino]ethyl]naphthalen-1-yl] 2-hydroxyacetate?
The IUPAC name of [5-[2-[[2-(4-chlorophenyl)-2-phenylethenyl]sulfonylamino]ethyl]naphthalen-1-yl] 2-hydroxyacetate (CID 67704886) is [5-[2-[[2-(4-chlorophenyl)-2-phenylethenyl]sulfonylamino]ethyl]naphthalen-1-yl] 2-hydroxyacetate.
What is the SMILES notation for [5-[2-[[2-(4-chlorophenyl)-2-phenylethenyl]sulfonylamino]ethyl]naphthalen-1-yl] 2-hydroxyacetate?
The canonical SMILES for [5-[2-[[2-(4-chlorophenyl)-2-phenylethenyl]sulfonylamino]ethyl]naphthalen-1-yl] 2-hydroxyacetate is O=C(CO)Oc1cccc2c(CCNS(=O)(=O)C=C(c3ccccc3)c3ccc(Cl)cc3)cccc12.
What is the InChIKey of [5-[2-[[2-(4-chlorophenyl)-2-phenylethenyl]sulfonylamino]ethyl]naphthalen-1-yl] 2-hydroxyacetate?
The InChIKey is XWIBXRCHRFLXBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24ClNO5S/c29-23-14-12-22(13-15-23)26(20-6-2-1-3-7-20)19-36(33,34)30-17-16-21-8-4-10-25-24(21)9-5-11-27(25)35-28(32)18-31/h1-15,19,30-31H,16-18H2.
What are the key properties of [5-[2-[[2-(4-chlorophenyl)-2-phenylethenyl]sulfonylamino]ethyl]naphthalen-1-yl] 2-hydroxyacetate?
[5-[2-[[2-(4-chlorophenyl)-2-phenylethenyl]sulfonylamino]ethyl]naphthalen-1-yl] 2-hydroxyacetate has a molecular weight of 522.02 g/mol, XLogP of 4.94, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[2-[[2-(4-chlorophenyl)-2-phenylethenyl]sulfonylamino]ethyl]naphthalen-1-yl] 2-hydroxyacetate is sourced from PubChem (CID 67704886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).