C36H40Cl4N4 — CID 67705161
5,10,15,20-tetrachloro-2,3,7,8,12,13,17,18-octaethylporphyrin (PubChem CID 67705161) has the molecular formula C36H40Cl4N4 and a molecular weight of 670.56 g/mol. Its IUPAC name is 5,10,15,20-tetrachloro-2,3,7,8,12,13,17,18-octaethylporphyrin.
| Compound Name | 5,10,15,20-tetrachloro-2,3,7,8,12,13,17,18-octaethylporphyrin |
|---|---|
| PubChem CID | 67705161 |
| Molecular Formula | C36H40Cl4N4 |
| Molecular Weight | 670.56 g/mol |
| Exact Mass | 668.20 |
| IUPAC Name | 5,10,15,20-tetrachloro-2,3,7,8,12,13,17,18-octaethylporphyrin |
| SMILES | CCC1=C(CC)/C2=C(\Cl)C3=N/C(=C(/Cl)C4=N/C(=C(/Cl)C5=N/C(=C(/Cl)C1=N2)C(CC)=C5CC)C(CC)=C4CC)C(CC)=C3CC |
| InChI | InChI=1S/C36H40Cl4N4/c1-9-17-18(10-2)30-26(38)32-21(13-5)22(14-6)34(43-32)28(40)36-24(16-8)23(15-7)35(44-36)27(39)33-20(12-4)19(11-3)31(42-33)25(37)29(17)41-30/h9-16H2,1-8H3/b29-25+,30-26+,31-25+,32-26+,33-27+,34-28+,35-27+,36-28+ |
| InChIKey | NRBFTTJRQMVNNO-CCHMHMSCSA-N |
| XLogP | 12.09 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.56 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |