C26H22Br2N4 — CID 67705263
2,7-dibromo-3,8,12,13,17,18-hexamethylporphyrin (PubChem CID 67705263) has the molecular formula C26H22Br2N4 and a molecular weight of 550.30 g/mol. Its IUPAC name is 2,7-dibromo-3,8,12,13,17,18-hexamethylporphyrin.
| Compound Name | 2,7-dibromo-3,8,12,13,17,18-hexamethylporphyrin |
|---|---|
| PubChem CID | 67705263 |
| Molecular Formula | C26H22Br2N4 |
| Molecular Weight | 550.30 g/mol |
| Exact Mass | 548.02 |
| IUPAC Name | 2,7-dibromo-3,8,12,13,17,18-hexamethylporphyrin |
| SMILES | CC1=C(C)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C(C)=C5Br)C(C)=C4Br)C(C)=C3C |
| InChI | InChI=1S/C26H22Br2N4/c1-11-12(2)19-8-21-15(5)25(27)24(31-21)10-22-16(6)26(28)23(32-22)9-20-14(4)13(3)18(30-20)7-17(11)29-19/h7-10H,1-6H3/b17-7-,18-7-,19-8-,20-9-,21-8-,22-10-,23-9-,24-10- |
| InChIKey | YXNJDODLHLRYOQ-CVNLHEROSA-N |
| XLogP | 7.36 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.30 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |