C24H22Br4N4 — CID 67705277
2,3,6,7-tetrabromo-1,4,5,8-tetramethyl-21,23-dihydro-5H-porphyrin (PubChem CID 67705277) has the molecular formula C24H22Br4N4 and a molecular weight of 686.08 g/mol. Its IUPAC name is 2,3,6,7-tetrabromo-1,4,5,8-tetramethyl-21,23-dihydro-5H-porphyrin.
| Compound Name | 2,3,6,7-tetrabromo-1,4,5,8-tetramethyl-21,23-dihydro-5H-porphyrin |
|---|---|
| PubChem CID | 67705277 |
| Molecular Formula | C24H22Br4N4 |
| Molecular Weight | 686.08 g/mol |
| Exact Mass | 681.86 |
| IUPAC Name | 2,3,6,7-tetrabromo-1,4,5,8-tetramethyl-21,23-dihydro-5H-porphyrin |
| SMILES | CC1=C(Br)C2(Br)N=C1C=c1ccc([nH]1)=CC1=NC(=CC3(C)NC(C)(C(Br)=C3Br)C2C)C=C1 |
| InChI | InChI=1S/C24H22Br4N4/c1-12-18-10-16-6-5-14(29-16)9-15-7-8-17(30-15)11-22(3)20(26)21(27)23(4,32-22)13(2)24(28,31-18)19(12)25/h5-11,13,29,32H,1-4H3 |
| InChIKey | RGPIJEPRBSUJDD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.08 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|