C48H56N4 — CID 67706104
4-[1-[3-[2-(4-aminophenyl)propyl]phenyl]propan-2-yl]aniline;4-[1-[4-[2-(4-aminophenyl)propyl]phenyl]propan-2-yl]aniline (PubChem CID 67706104) has the molecular formula C48H56N4 and a molecular weight of 689.00 g/mol. Its IUPAC name is 4-[1-[3-[2-(4-aminophenyl)propyl]phenyl]propan-2-yl]aniline;4-[1-[4-[2-(4-aminophenyl)propyl]phenyl]propan-2-yl]aniline.
| Compound Name | 4-[1-[3-[2-(4-aminophenyl)propyl]phenyl]propan-2-yl]aniline;4-[1-[4-[2-(4-aminophenyl)propyl]phenyl]propan-2-yl]aniline |
|---|---|
| PubChem CID | 67706104 |
| Molecular Formula | C48H56N4 |
| Molecular Weight | 689.00 g/mol |
| Exact Mass | 688.45 |
| IUPAC Name | 4-[1-[3-[2-(4-aminophenyl)propyl]phenyl]propan-2-yl]aniline;4-[1-[4-[2-(4-aminophenyl)propyl]phenyl]propan-2-yl]aniline |
| SMILES | CC(Cc1ccc(CC(C)c2ccc(N)cc2)cc1)c1ccc(N)cc1.CC(Cc1cccc(CC(C)c2ccc(N)cc2)c1)c1ccc(N)cc1 |
| InChI | InChI=1S/2C24H28N2/c1-17(21-7-11-23(25)12-8-21)15-19-3-5-20(6-4-19)16-18(2)22-9-13-24(26)14-10-22;1-17(21-6-10-23(25)11-7-21)14-19-4-3-5-20(16-19)15-18(2)22-8-12-24(26)13-9-22/h3-14,17-18H,15-16,25-26H2,1-2H3;3-13,16-18H,14-15,25-26H2,1-2H3 |
| InChIKey | UILBBHIZSUVDIA-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.00 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|