C18H29N3O5 — CID 67706358
1,1-diethoxy-N,N-dimethylmethanamine;3-(dimethylamino)-1-(3-nitrophenyl)prop-2-en-1-one (PubChem CID 67706358) has the molecular formula C18H29N3O5 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1,1-diethoxy-N,N-dimethylmethanamine;3-(dimethylamino)-1-(3-nitrophenyl)prop-2-en-1-one.
| Compound Name | 1,1-diethoxy-N,N-dimethylmethanamine;3-(dimethylamino)-1-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 67706358 |
| Molecular Formula | C18H29N3O5 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 1,1-diethoxy-N,N-dimethylmethanamine;3-(dimethylamino)-1-(3-nitrophenyl)prop-2-en-1-one |
| SMILES | CCOC(OCC)N(C)C.CN(C)C=CC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H12N2O3.C7H17NO2/c1-12(2)7-6-11(14)9-4-3-5-10(8-9)13(15)16;1-5-9-7(8(3)4)10-6-2/h3-8H,1-2H3;7H,5-6H2,1-4H3 |
| InChIKey | LLVACWVJGYLZDO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|