C30H52O6Si — CID 67706592
(E,9R,12S)-8-acetyl-12-[tert-butyl(dimethyl)silyl]oxy-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadec-10-en-5-ynoic acid (PubChem CID 67706592) has the molecular formula C30H52O6Si and a molecular weight of 536.83 g/mol. Its IUPAC name is (E,9R,12S)-8-acetyl-12-[tert-butyl(dimethyl)silyl]oxy-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadec-10-en-5-ynoic acid.
| Compound Name | (E,9R,12S)-8-acetyl-12-[tert-butyl(dimethyl)silyl]oxy-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadec-10-en-5-ynoic acid |
|---|---|
| PubChem CID | 67706592 |
| Molecular Formula | C30H52O6Si |
| Molecular Weight | 536.83 g/mol |
| Exact Mass | 536.35 |
| IUPAC Name | (E,9R,12S)-8-acetyl-12-[tert-butyl(dimethyl)silyl]oxy-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadec-10-en-5-ynoic acid |
| SMILES | CCCCC[C@@H](/C=C/[C@H](C(CC#CCCCC(=O)O)C(C)=O)[C@@H]1COC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H52O6Si/c1-10-11-14-17-24(36-37(8,9)29(3,4)5)20-21-26(27-22-34-30(6,7)35-27)25(23(2)31)18-15-12-13-16-19-28(32)33/h20-21,24-27H,10-11,13-14,16-19,22H2,1-9H3,(H,32,33)/b21-20+/t24-,25?,26+,27-/m0/s1 |
| InChIKey | YLRFFPHNSMGVKV-ANOAYPTGSA-N |
| XLogP | 7.13 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.83 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|