About 2-(2-benzamido-1,3-thiazol-4-yl)acetic acid
2-(2-benzamido-1,3-thiazol-4-yl)acetic acid (PubChem CID 677066) has the molecular formula C12H10N2O3S
and a molecular weight of 262.29 g/mol. Its IUPAC name is 2-(2-benzamido-1,3-thiazol-4-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(2-benzamido-1,3-thiazol-4-yl)acetic acid |
| PubChem CID | 677066 |
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-(2-benzamido-1,3-thiazol-4-yl)acetic acid |
| SMILES | O=C(O)Cc1csc(NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C12H10N2O3S/c15-10(16)6-9-7-18-12(13-9)14-11(17)8-4-2-1-3-5-8/h1-5,7H,6H2,(H,15,16)(H,13,14,17) |
| InChIKey | YUASLJXAXQANLW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-benzamido-1,3-thiazol-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-benzamido-1,3-thiazol-4-yl)acetic acid?
The IUPAC name of 2-(2-benzamido-1,3-thiazol-4-yl)acetic acid (CID 677066) is 2-(2-benzamido-1,3-thiazol-4-yl)acetic acid.
What is the SMILES notation for 2-(2-benzamido-1,3-thiazol-4-yl)acetic acid?
The canonical SMILES for 2-(2-benzamido-1,3-thiazol-4-yl)acetic acid is O=C(O)Cc1csc(NC(=O)c2ccccc2)n1.
What is the InChIKey of 2-(2-benzamido-1,3-thiazol-4-yl)acetic acid?
The InChIKey is YUASLJXAXQANLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O3S/c15-10(16)6-9-7-18-12(13-9)14-11(17)8-4-2-1-3-5-8/h1-5,7H,6H2,(H,15,16)(H,13,14,17).
What are the key properties of 2-(2-benzamido-1,3-thiazol-4-yl)acetic acid?
2-(2-benzamido-1,3-thiazol-4-yl)acetic acid has a molecular weight of 262.29 g/mol, XLogP of 2.02, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-benzamido-1,3-thiazol-4-yl)acetic acid is sourced from PubChem (CID 677066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).