C30H54O6Si — CID 67706704
(5Z,9R,10E,12S)-8-acetyl-12-[tert-butyl(dimethyl)silyl]oxy-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-5,10-dienoic acid (PubChem CID 67706704) has the molecular formula C30H54O6Si and a molecular weight of 538.84 g/mol. Its IUPAC name is (5Z,9R,10E,12S)-8-acetyl-12-[tert-butyl(dimethyl)silyl]oxy-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-5,10-dienoic acid.
| Compound Name | (5Z,9R,10E,12S)-8-acetyl-12-[tert-butyl(dimethyl)silyl]oxy-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-5,10-dienoic acid |
|---|---|
| PubChem CID | 67706704 |
| Molecular Formula | C30H54O6Si |
| Molecular Weight | 538.84 g/mol |
| Exact Mass | 538.37 |
| IUPAC Name | (5Z,9R,10E,12S)-8-acetyl-12-[tert-butyl(dimethyl)silyl]oxy-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-5,10-dienoic acid |
| SMILES | CCCCC[C@@H](/C=C/[C@H](C(C/C=C\CCCC(=O)O)C(C)=O)[C@@H]1COC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H54O6Si/c1-10-11-14-17-24(36-37(8,9)29(3,4)5)20-21-26(27-22-34-30(6,7)35-27)25(23(2)31)18-15-12-13-16-19-28(32)33/h12,15,20-21,24-27H,10-11,13-14,16-19,22H2,1-9H3,(H,32,33)/b15-12-,21-20+/t24-,25?,26+,27-/m0/s1 |
| InChIKey | PQNYYPXEYDRESA-QQRMFZCCSA-N |
| XLogP | 7.69 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.84 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|