About 3,5-diethyl-4-phenyl-2-propyl-1,4-dihydropyridine
3,5-diethyl-4-phenyl-2-propyl-1,4-dihydropyridine (PubChem CID 67707378) has the molecular formula C18H25N
and a molecular weight of 255.41 g/mol. Its IUPAC name is 3,5-diethyl-4-phenyl-2-propyl-1,4-dihydropyridine.
Molecular Properties
| Compound Name | 3,5-diethyl-4-phenyl-2-propyl-1,4-dihydropyridine |
| PubChem CID | 67707378 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 3,5-diethyl-4-phenyl-2-propyl-1,4-dihydropyridine |
| SMILES | CCCC1=C(CC)C(c2ccccc2)C(CC)=CN1 |
| InChI | InChI=1S/C18H25N/c1-4-10-17-16(6-3)18(14(5-2)13-19-17)15-11-8-7-9-12-15/h7-9,11-13,18-19H,4-6,10H2,1-3H3 |
| InChIKey | CGQZSSISYMCRPB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-diethyl-4-phenyl-2-propyl-1,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-4-phenyl-2-propyl-1,4-dihydropyridine?
The IUPAC name of 3,5-diethyl-4-phenyl-2-propyl-1,4-dihydropyridine (CID 67707378) is 3,5-diethyl-4-phenyl-2-propyl-1,4-dihydropyridine.
What is the SMILES notation for 3,5-diethyl-4-phenyl-2-propyl-1,4-dihydropyridine?
The canonical SMILES for 3,5-diethyl-4-phenyl-2-propyl-1,4-dihydropyridine is CCCC1=C(CC)C(c2ccccc2)C(CC)=CN1.
What is the InChIKey of 3,5-diethyl-4-phenyl-2-propyl-1,4-dihydropyridine?
The InChIKey is CGQZSSISYMCRPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N/c1-4-10-17-16(6-3)18(14(5-2)13-19-17)15-11-8-7-9-12-15/h7-9,11-13,18-19H,4-6,10H2,1-3H3.
What are the key properties of 3,5-diethyl-4-phenyl-2-propyl-1,4-dihydropyridine?
3,5-diethyl-4-phenyl-2-propyl-1,4-dihydropyridine has a molecular weight of 255.41 g/mol, XLogP of 5.13, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-4-phenyl-2-propyl-1,4-dihydropyridine is sourced from PubChem (CID 67707378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).