C8H13NO4 — CID 67707947
(1S,2R,8R,8aR)-1,2,3,5,8,8a-hexahydroindolizine-1,2,5,8-tetrol (PubChem CID 67707947) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is (1S,2R,8R,8aR)-1,2,3,5,8,8a-hexahydroindolizine-1,2,5,8-tetrol.
| Compound Name | (1S,2R,8R,8aR)-1,2,3,5,8,8a-hexahydroindolizine-1,2,5,8-tetrol |
|---|---|
| PubChem CID | 67707947 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (1S,2R,8R,8aR)-1,2,3,5,8,8a-hexahydroindolizine-1,2,5,8-tetrol |
| SMILES | OC1C=C[C@@H](O)[C@@H]2[C@H](O)[C@H](O)CN12 |
| InChI | InChI=1S/C8H13NO4/c10-4-1-2-6(12)9-3-5(11)8(13)7(4)9/h1-2,4-8,10-13H,3H2/t4-,5-,6?,7-,8-/m1/s1 |
| InChIKey | UGEFLCFIEQOKDQ-WFVKVJENSA-N |
| XLogP | -2.36 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|