About [6-fluoro-1-(4-pyridin-2-ylbutyl)-2,3-dihydroindol-5-yl] N-methylcarbamate
[6-fluoro-1-(4-pyridin-2-ylbutyl)-2,3-dihydroindol-5-yl] N-methylcarbamate (PubChem CID 67708133) has the molecular formula C19H22FN3O2
and a molecular weight of 343.40 g/mol. Its IUPAC name is [6-fluoro-1-(4-pyridin-2-ylbutyl)-2,3-dihydroindol-5-yl] N-methylcarbamate.
Molecular Properties
| Compound Name | [6-fluoro-1-(4-pyridin-2-ylbutyl)-2,3-dihydroindol-5-yl] N-methylcarbamate |
| PubChem CID | 67708133 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | [6-fluoro-1-(4-pyridin-2-ylbutyl)-2,3-dihydroindol-5-yl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cc2c(cc1F)N(CCCCc1ccccn1)CC2 |
| InChI | InChI=1S/C19H22FN3O2/c1-21-19(24)25-18-12-14-8-11-23(17(14)13-16(18)20)10-5-3-7-15-6-2-4-9-22-15/h2,4,6,9,12-13H,3,5,7-8,10-11H2,1H3,(H,21,24) |
| InChIKey | CKDMHRHOFKJVIC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [6-fluoro-1-(4-pyridin-2-ylbutyl)-2,3-dihydroindol-5-yl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-fluoro-1-(4-pyridin-2-ylbutyl)-2,3-dihydroindol-5-yl] N-methylcarbamate?
The IUPAC name of [6-fluoro-1-(4-pyridin-2-ylbutyl)-2,3-dihydroindol-5-yl] N-methylcarbamate (CID 67708133) is [6-fluoro-1-(4-pyridin-2-ylbutyl)-2,3-dihydroindol-5-yl] N-methylcarbamate.
What is the SMILES notation for [6-fluoro-1-(4-pyridin-2-ylbutyl)-2,3-dihydroindol-5-yl] N-methylcarbamate?
The canonical SMILES for [6-fluoro-1-(4-pyridin-2-ylbutyl)-2,3-dihydroindol-5-yl] N-methylcarbamate is CNC(=O)Oc1cc2c(cc1F)N(CCCCc1ccccn1)CC2.
What is the InChIKey of [6-fluoro-1-(4-pyridin-2-ylbutyl)-2,3-dihydroindol-5-yl] N-methylcarbamate?
The InChIKey is CKDMHRHOFKJVIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22FN3O2/c1-21-19(24)25-18-12-14-8-11-23(17(14)13-16(18)20)10-5-3-7-15-6-2-4-9-22-15/h2,4,6,9,12-13H,3,5,7-8,10-11H2,1H3,(H,21,24).
What are the key properties of [6-fluoro-1-(4-pyridin-2-ylbutyl)-2,3-dihydroindol-5-yl] N-methylcarbamate?
[6-fluoro-1-(4-pyridin-2-ylbutyl)-2,3-dihydroindol-5-yl] N-methylcarbamate has a molecular weight of 343.40 g/mol, XLogP of 3.32, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-fluoro-1-(4-pyridin-2-ylbutyl)-2,3-dihydroindol-5-yl] N-methylcarbamate is sourced from PubChem (CID 67708133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).