About 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(imidazol-1-ylmethyl)phenyl]octanamide
3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(imidazol-1-ylmethyl)phenyl]octanamide (PubChem CID 67708202) has the molecular formula C29H37N3O3
and a molecular weight of 475.63 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(imidazol-1-ylmethyl)phenyl]octanamide.
Molecular Properties
| Compound Name | 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(imidazol-1-ylmethyl)phenyl]octanamide |
| PubChem CID | 67708202 |
| Molecular Formula | C29H37N3O3 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(imidazol-1-ylmethyl)phenyl]octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(Cn2ccnc2)ccc1C(C)(C)C)c1cccc2c1OCO2 |
| InChI | InChI=1S/C29H37N3O3/c1-5-6-7-9-22(23-10-8-11-26-28(23)35-20-34-26)17-27(33)31-25-16-21(18-32-15-14-30-19-32)12-13-24(25)29(2,3)4/h8,10-16,19,22H,5-7,9,17-18,20H2,1-4H3,(H,31,33) |
| InChIKey | UXMGGDDHGHHIQC-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(imidazol-1-ylmethyl)phenyl]octanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(imidazol-1-ylmethyl)phenyl]octanamide?
The IUPAC name of 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(imidazol-1-ylmethyl)phenyl]octanamide (CID 67708202) is 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(imidazol-1-ylmethyl)phenyl]octanamide.
What is the SMILES notation for 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(imidazol-1-ylmethyl)phenyl]octanamide?
The canonical SMILES for 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(imidazol-1-ylmethyl)phenyl]octanamide is CCCCCC(CC(=O)Nc1cc(Cn2ccnc2)ccc1C(C)(C)C)c1cccc2c1OCO2.
What is the InChIKey of 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(imidazol-1-ylmethyl)phenyl]octanamide?
The InChIKey is UXMGGDDHGHHIQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H37N3O3/c1-5-6-7-9-22(23-10-8-11-26-28(23)35-20-34-26)17-27(33)31-25-16-21(18-32-15-14-30-19-32)12-13-24(25)29(2,3)4/h8,10-16,19,22H,5-7,9,17-18,20H2,1-4H3,(H,31,33).
What are the key properties of 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(imidazol-1-ylmethyl)phenyl]octanamide?
3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(imidazol-1-ylmethyl)phenyl]octanamide has a molecular weight of 475.63 g/mol, XLogP of 6.65, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(imidazol-1-ylmethyl)phenyl]octanamide is sourced from PubChem (CID 67708202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).