C13H26O3Si2 — CID 67708537
2-methyl-3-(2,2,3,6,6-pentamethyloxadisilinan-3-yl)but-2-enoic acid (PubChem CID 67708537) has the molecular formula C13H26O3Si2 and a molecular weight of 286.52 g/mol. Its IUPAC name is 2-methyl-3-(2,2,3,6,6-pentamethyloxadisilinan-3-yl)but-2-enoic acid.
| Compound Name | 2-methyl-3-(2,2,3,6,6-pentamethyloxadisilinan-3-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 67708537 |
| Molecular Formula | C13H26O3Si2 |
| Molecular Weight | 286.52 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-methyl-3-(2,2,3,6,6-pentamethyloxadisilinan-3-yl)but-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)[Si]1(C)CCC(C)(C)O[Si]1(C)C |
| InChI | InChI=1S/C13H26O3Si2/c1-10(12(14)15)11(2)18(7)9-8-13(3,4)16-17(18,5)6/h8-9H2,1-7H3,(H,14,15) |
| InChIKey | JWSXMLMDDZWSDB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|