About cyclopropane;bis(1,1-dimethylpiperidin-1-ium)
cyclopropane;bis(1,1-dimethylpiperidin-1-ium) (PubChem CID 67708683) has the molecular formula C17H38N2+2
and a molecular weight of 270.50 g/mol. Its IUPAC name is cyclopropane;bis(1,1-dimethylpiperidin-1-ium).
Molecular Properties
| Compound Name | cyclopropane;bis(1,1-dimethylpiperidin-1-ium) |
| PubChem CID | 67708683 |
| Molecular Formula | C17H38N2+2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | cyclopropane;bis(1,1-dimethylpiperidin-1-ium) |
| SMILES | C1CC1.C[N+]1(C)CCCCC1.C[N+]1(C)CCCCC1 |
| InChI | InChI=1S/2C7H16N.C3H6/c2*1-8(2)6-4-3-5-7-8;1-2-3-1/h2*3-7H2,1-2H3;1-3H2/q2*+1; |
| InChIKey | BKCCMCCFNJJEMX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze cyclopropane;bis(1,1-dimethylpiperidin-1-ium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;bis(1,1-dimethylpiperidin-1-ium)?
The IUPAC name of cyclopropane;bis(1,1-dimethylpiperidin-1-ium) (CID 67708683) is cyclopropane;bis(1,1-dimethylpiperidin-1-ium).
What is the SMILES notation for cyclopropane;bis(1,1-dimethylpiperidin-1-ium)?
The canonical SMILES for cyclopropane;bis(1,1-dimethylpiperidin-1-ium) is C1CC1.C[N+]1(C)CCCCC1.C[N+]1(C)CCCCC1.
What is the InChIKey of cyclopropane;bis(1,1-dimethylpiperidin-1-ium)?
The InChIKey is BKCCMCCFNJJEMX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H16N.C3H6/c2*1-8(2)6-4-3-5-7-8;1-2-3-1/h2*3-7H2,1-2H3;1-3H2/q2*+1;.
What are the key properties of cyclopropane;bis(1,1-dimethylpiperidin-1-ium)?
cyclopropane;bis(1,1-dimethylpiperidin-1-ium) has a molecular weight of 270.50 g/mol, XLogP of 3.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;bis(1,1-dimethylpiperidin-1-ium) is sourced from PubChem (CID 67708683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).