About 2-cyclopentyl-2-ethylpropane-1,3-diol;bis(2-methylprop-2-enoic acid)
2-cyclopentyl-2-ethylpropane-1,3-diol;bis(2-methylprop-2-enoic acid) (PubChem CID 67708962) has the molecular formula C18H32O6
and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-cyclopentyl-2-ethylpropane-1,3-diol;bis(2-methylprop-2-enoic acid).
Molecular Properties
| Compound Name | 2-cyclopentyl-2-ethylpropane-1,3-diol;bis(2-methylprop-2-enoic acid) |
| PubChem CID | 67708962 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 2-cyclopentyl-2-ethylpropane-1,3-diol;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.CCC(CO)(CO)C1CCCC1 |
| InChI | InChI=1S/C10H20O2.2C4H6O2/c1-2-10(7-11,8-12)9-5-3-4-6-9;2*1-3(2)4(5)6/h9,11-12H,2-8H2,1H3;2*1H2,2H3,(H,5,6) |
| InChIKey | HLKNTCJAMXKZFS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentyl-2-ethylpropane-1,3-diol;bis(2-methylprop-2-enoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-2-ethylpropane-1,3-diol;bis(2-methylprop-2-enoic acid)?
The IUPAC name of 2-cyclopentyl-2-ethylpropane-1,3-diol;bis(2-methylprop-2-enoic acid) (CID 67708962) is 2-cyclopentyl-2-ethylpropane-1,3-diol;bis(2-methylprop-2-enoic acid).
What is the SMILES notation for 2-cyclopentyl-2-ethylpropane-1,3-diol;bis(2-methylprop-2-enoic acid)?
The canonical SMILES for 2-cyclopentyl-2-ethylpropane-1,3-diol;bis(2-methylprop-2-enoic acid) is C=C(C)C(=O)O.C=C(C)C(=O)O.CCC(CO)(CO)C1CCCC1.
What is the InChIKey of 2-cyclopentyl-2-ethylpropane-1,3-diol;bis(2-methylprop-2-enoic acid)?
The InChIKey is HLKNTCJAMXKZFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.2C4H6O2/c1-2-10(7-11,8-12)9-5-3-4-6-9;2*1-3(2)4(5)6/h9,11-12H,2-8H2,1H3;2*1H2,2H3,(H,5,6).
What are the key properties of 2-cyclopentyl-2-ethylpropane-1,3-diol;bis(2-methylprop-2-enoic acid)?
2-cyclopentyl-2-ethylpropane-1,3-diol;bis(2-methylprop-2-enoic acid) has a molecular weight of 344.45 g/mol, XLogP of 2.85, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-2-ethylpropane-1,3-diol;bis(2-methylprop-2-enoic acid) is sourced from PubChem (CID 67708962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).