C13H25N3 — CID 67709044
9-methyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazole-3,6-diamine (PubChem CID 67709044) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 9-methyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazole-3,6-diamine.
| Compound Name | 9-methyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazole-3,6-diamine |
|---|---|
| PubChem CID | 67709044 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 9-methyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazole-3,6-diamine |
| SMILES | CN1C2CCC(N)CC2C2CC(N)CCC21 |
| InChI | InChI=1S/C13H25N3/c1-16-12-4-2-8(14)6-10(12)11-7-9(15)3-5-13(11)16/h8-13H,2-7,14-15H2,1H3 |
| InChIKey | OBVDPPSNNIBBQC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |