About ethyl 4-[2-(4-fluorophenyl)-3,4-dihydroxy-5-methyl-6-oxo-1-pyridinyl]butanoate
ethyl 4-[2-(4-fluorophenyl)-3,4-dihydroxy-5-methyl-6-oxo-1-pyridinyl]butanoate (PubChem CID 67709052) has the molecular formula C18H20FNO5
and a molecular weight of 349.36 g/mol. Its IUPAC name is ethyl 4-[2-(4-fluorophenyl)-3,4-dihydroxy-5-methyl-6-oxo-1-pyridinyl]butanoate.
Molecular Properties
| Compound Name | ethyl 4-[2-(4-fluorophenyl)-3,4-dihydroxy-5-methyl-6-oxo-1-pyridinyl]butanoate |
| PubChem CID | 67709052 |
| Molecular Formula | C18H20FNO5 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | ethyl 4-[2-(4-fluorophenyl)-3,4-dihydroxy-5-methyl-6-oxo-1-pyridinyl]butanoate |
| SMILES | CCOC(=O)CCCn1c(-c2ccc(F)cc2)c(O)c(O)c(C)c1=O |
| InChI | InChI=1S/C18H20FNO5/c1-3-25-14(21)5-4-10-20-15(12-6-8-13(19)9-7-12)17(23)16(22)11(2)18(20)24/h6-9,22-23H,3-5,10H2,1-2H3 |
| InChIKey | YWSLDPKSPWITCV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[2-(4-fluorophenyl)-3,4-dihydroxy-5-methyl-6-oxo-1-pyridinyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-(4-fluorophenyl)-3,4-dihydroxy-5-methyl-6-oxo-1-pyridinyl]butanoate?
The IUPAC name of ethyl 4-[2-(4-fluorophenyl)-3,4-dihydroxy-5-methyl-6-oxo-1-pyridinyl]butanoate (CID 67709052) is ethyl 4-[2-(4-fluorophenyl)-3,4-dihydroxy-5-methyl-6-oxo-1-pyridinyl]butanoate.
What is the SMILES notation for ethyl 4-[2-(4-fluorophenyl)-3,4-dihydroxy-5-methyl-6-oxo-1-pyridinyl]butanoate?
The canonical SMILES for ethyl 4-[2-(4-fluorophenyl)-3,4-dihydroxy-5-methyl-6-oxo-1-pyridinyl]butanoate is CCOC(=O)CCCn1c(-c2ccc(F)cc2)c(O)c(O)c(C)c1=O.
What is the InChIKey of ethyl 4-[2-(4-fluorophenyl)-3,4-dihydroxy-5-methyl-6-oxo-1-pyridinyl]butanoate?
The InChIKey is YWSLDPKSPWITCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FNO5/c1-3-25-14(21)5-4-10-20-15(12-6-8-13(19)9-7-12)17(23)16(22)11(2)18(20)24/h6-9,22-23H,3-5,10H2,1-2H3.
What are the key properties of ethyl 4-[2-(4-fluorophenyl)-3,4-dihydroxy-5-methyl-6-oxo-1-pyridinyl]butanoate?
ethyl 4-[2-(4-fluorophenyl)-3,4-dihydroxy-5-methyl-6-oxo-1-pyridinyl]butanoate has a molecular weight of 349.36 g/mol, XLogP of 2.72, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-(4-fluorophenyl)-3,4-dihydroxy-5-methyl-6-oxo-1-pyridinyl]butanoate is sourced from PubChem (CID 67709052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).