About 2,3-di(cyclopenten-1-yl)prop-2-enoic acid;1-hydroxyprop-2-enyl prop-2-enoate
2,3-di(cyclopenten-1-yl)prop-2-enoic acid;1-hydroxyprop-2-enyl prop-2-enoate (PubChem CID 67709469) has the molecular formula C19H24O5
and a molecular weight of 332.40 g/mol. Its IUPAC name is 2,3-di(cyclopenten-1-yl)prop-2-enoic acid;1-hydroxyprop-2-enyl prop-2-enoate.
Molecular Properties
| Compound Name | 2,3-di(cyclopenten-1-yl)prop-2-enoic acid;1-hydroxyprop-2-enyl prop-2-enoate |
| PubChem CID | 67709469 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2,3-di(cyclopenten-1-yl)prop-2-enoic acid;1-hydroxyprop-2-enyl prop-2-enoate |
| SMILES | C=CC(=O)OC(O)C=C.O=C(O)C(=CC1=CCCC1)C1=CCCC1 |
| InChI | InChI=1S/C13H16O2.C6H8O3/c14-13(15)12(11-7-3-4-8-11)9-10-5-1-2-6-10;1-3-5(7)9-6(8)4-2/h5,7,9H,1-4,6,8H2,(H,14,15);3-5,7H,1-2H2 |
| InChIKey | ZSFVBQWRXYQNRM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-di(cyclopenten-1-yl)prop-2-enoic acid;1-hydroxyprop-2-enyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(cyclopenten-1-yl)prop-2-enoic acid;1-hydroxyprop-2-enyl prop-2-enoate?
The IUPAC name of 2,3-di(cyclopenten-1-yl)prop-2-enoic acid;1-hydroxyprop-2-enyl prop-2-enoate (CID 67709469) is 2,3-di(cyclopenten-1-yl)prop-2-enoic acid;1-hydroxyprop-2-enyl prop-2-enoate.
What is the SMILES notation for 2,3-di(cyclopenten-1-yl)prop-2-enoic acid;1-hydroxyprop-2-enyl prop-2-enoate?
The canonical SMILES for 2,3-di(cyclopenten-1-yl)prop-2-enoic acid;1-hydroxyprop-2-enyl prop-2-enoate is C=CC(=O)OC(O)C=C.O=C(O)C(=CC1=CCCC1)C1=CCCC1.
What is the InChIKey of 2,3-di(cyclopenten-1-yl)prop-2-enoic acid;1-hydroxyprop-2-enyl prop-2-enoate?
The InChIKey is ZSFVBQWRXYQNRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2.C6H8O3/c14-13(15)12(11-7-3-4-8-11)9-10-5-1-2-6-10;1-3-5(7)9-6(8)4-2/h5,7,9H,1-4,6,8H2,(H,14,15);3-5,7H,1-2H2.
What are the key properties of 2,3-di(cyclopenten-1-yl)prop-2-enoic acid;1-hydroxyprop-2-enyl prop-2-enoate?
2,3-di(cyclopenten-1-yl)prop-2-enoic acid;1-hydroxyprop-2-enyl prop-2-enoate has a molecular weight of 332.40 g/mol, XLogP of 3.44, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(cyclopenten-1-yl)prop-2-enoic acid;1-hydroxyprop-2-enyl prop-2-enoate is sourced from PubChem (CID 67709469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).