C26H31N5O8 — CID 67709570
acetic acid;2-[[3-[[(E)-3-(4-carbamimidoylphenyl)prop-2-enoyl]amino]propyl-(carboxymethyl)carbamoyl]amino]-2-phenylacetic acid (PubChem CID 67709570) has the molecular formula C26H31N5O8 and a molecular weight of 541.56 g/mol. Its IUPAC name is acetic acid;2-[[3-[[(E)-3-(4-carbamimidoylphenyl)prop-2-enoyl]amino]propyl-(carboxymethyl)carbamoyl]amino]-2-phenylacetic acid.
| Compound Name | acetic acid;2-[[3-[[(E)-3-(4-carbamimidoylphenyl)prop-2-enoyl]amino]propyl-(carboxymethyl)carbamoyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 67709570 |
| Molecular Formula | C26H31N5O8 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | acetic acid;2-[[3-[[(E)-3-(4-carbamimidoylphenyl)prop-2-enoyl]amino]propyl-(carboxymethyl)carbamoyl]amino]-2-phenylacetic acid |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(/C=C/C(=O)NCCCN(CC(=O)O)C(=O)NC(C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H27N5O6.C2H4O2/c25-22(26)18-10-7-16(8-11-18)9-12-19(30)27-13-4-14-29(15-20(31)32)24(35)28-21(23(33)34)17-5-2-1-3-6-17;1-2(3)4/h1-3,5-12,21H,4,13-15H2,(H3,25,26)(H,27,30)(H,28,35)(H,31,32)(H,33,34);1H3,(H,3,4)/b12-9+; |
| InChIKey | GQAOLNRDYGJTPU-NBYYMMLRSA-N |
| XLogP | 1.50 |
| TPSA | 223.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|