C28H39NO4 — CID 67710063
N-nonyl-N-(2,4,6-trimethoxyphenyl)-2,3-dihydro-1H-indene-2-carboxamide (PubChem CID 67710063) has the molecular formula C28H39NO4 and a molecular weight of 453.62 g/mol. Its IUPAC name is N-nonyl-N-(2,4,6-trimethoxyphenyl)-2,3-dihydro-1H-indene-2-carboxamide.
| Compound Name | N-nonyl-N-(2,4,6-trimethoxyphenyl)-2,3-dihydro-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 67710063 |
| Molecular Formula | C28H39NO4 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | N-nonyl-N-(2,4,6-trimethoxyphenyl)-2,3-dihydro-1H-indene-2-carboxamide |
| SMILES | CCCCCCCCCN(C(=O)C1Cc2ccccc2C1)c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C28H39NO4/c1-5-6-7-8-9-10-13-16-29(27-25(32-3)19-24(31-2)20-26(27)33-4)28(30)23-17-21-14-11-12-15-22(21)18-23/h11-12,14-15,19-20,23H,5-10,13,16-18H2,1-4H3 |
| InChIKey | IHTRIBHWTRQUKI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|