About ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methyl-3H-pyrazole-4-carboxylate
ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methyl-3H-pyrazole-4-carboxylate (PubChem CID 67710272) has the molecular formula C14H20N6O7S
and a molecular weight of 416.42 g/mol. Its IUPAC name is ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methyl-3H-pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methyl-3H-pyrazole-4-carboxylate |
| PubChem CID | 67710272 |
| Molecular Formula | C14H20N6O7S |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methyl-3H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)C1=CN(C)N(S(=O)(=O)NC(=O)Nc2nc(OC)cc(OC)n2)C1 |
| InChI | InChI=1S/C14H20N6O7S/c1-5-27-12(21)9-7-19(2)20(8-9)28(23,24)18-14(22)17-13-15-10(25-3)6-11(16-13)26-4/h6-7H,5,8H2,1-4H3,(H2,15,16,17,18,22) |
| InChIKey | GHQVJCOOZRFXPA-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methyl-3H-pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methyl-3H-pyrazole-4-carboxylate?
The IUPAC name of ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methyl-3H-pyrazole-4-carboxylate (CID 67710272) is ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methyl-3H-pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methyl-3H-pyrazole-4-carboxylate?
The canonical SMILES for ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methyl-3H-pyrazole-4-carboxylate is CCOC(=O)C1=CN(C)N(S(=O)(=O)NC(=O)Nc2nc(OC)cc(OC)n2)C1.
What is the InChIKey of ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methyl-3H-pyrazole-4-carboxylate?
The InChIKey is GHQVJCOOZRFXPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N6O7S/c1-5-27-12(21)9-7-19(2)20(8-9)28(23,24)18-14(22)17-13-15-10(25-3)6-11(16-13)26-4/h6-7H,5,8H2,1-4H3,(H2,15,16,17,18,22).
What are the key properties of ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methyl-3H-pyrazole-4-carboxylate?
ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methyl-3H-pyrazole-4-carboxylate has a molecular weight of 416.42 g/mol, XLogP of -0.53, 7 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methyl-3H-pyrazole-4-carboxylate is sourced from PubChem (CID 67710272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).