About 2-cyclohexyl-3,6-dihydro-1H-pyridazine
2-cyclohexyl-3,6-dihydro-1H-pyridazine (PubChem CID 67710417) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 2-cyclohexyl-3,6-dihydro-1H-pyridazine.
Molecular Properties
| Compound Name | 2-cyclohexyl-3,6-dihydro-1H-pyridazine |
| PubChem CID | 67710417 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 2-cyclohexyl-3,6-dihydro-1H-pyridazine |
| SMILES | C1=CCN(C2CCCCC2)NC1 |
| InChI | InChI=1S/C10H18N2/c1-2-6-10(7-3-1)12-9-5-4-8-11-12/h4-5,10-11H,1-3,6-9H2 |
| InChIKey | PQMPKLBMQSSNKH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-3,6-dihydro-1H-pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-3,6-dihydro-1H-pyridazine?
The IUPAC name of 2-cyclohexyl-3,6-dihydro-1H-pyridazine (CID 67710417) is 2-cyclohexyl-3,6-dihydro-1H-pyridazine.
What is the SMILES notation for 2-cyclohexyl-3,6-dihydro-1H-pyridazine?
The canonical SMILES for 2-cyclohexyl-3,6-dihydro-1H-pyridazine is C1=CCN(C2CCCCC2)NC1.
What is the InChIKey of 2-cyclohexyl-3,6-dihydro-1H-pyridazine?
The InChIKey is PQMPKLBMQSSNKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-2-6-10(7-3-1)12-9-5-4-8-11-12/h4-5,10-11H,1-3,6-9H2.
What are the key properties of 2-cyclohexyl-3,6-dihydro-1H-pyridazine?
2-cyclohexyl-3,6-dihydro-1H-pyridazine has a molecular weight of 166.27 g/mol, XLogP of 1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-3,6-dihydro-1H-pyridazine is sourced from PubChem (CID 67710417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).