About (3,5-dihydroxyphenyl) 2-phenylacetate
(3,5-dihydroxyphenyl) 2-phenylacetate (PubChem CID 67711306) has the molecular formula C14H12O4
and a molecular weight of 244.25 g/mol. Its IUPAC name is (3,5-dihydroxyphenyl) 2-phenylacetate.
Molecular Properties
| Compound Name | (3,5-dihydroxyphenyl) 2-phenylacetate |
| PubChem CID | 67711306 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (3,5-dihydroxyphenyl) 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)Oc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C14H12O4/c15-11-7-12(16)9-13(8-11)18-14(17)6-10-4-2-1-3-5-10/h1-5,7-9,15-16H,6H2 |
| InChIKey | HEDDTPGJYSBDHS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dihydroxyphenyl) 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dihydroxyphenyl) 2-phenylacetate?
The IUPAC name of (3,5-dihydroxyphenyl) 2-phenylacetate (CID 67711306) is (3,5-dihydroxyphenyl) 2-phenylacetate.
What is the SMILES notation for (3,5-dihydroxyphenyl) 2-phenylacetate?
The canonical SMILES for (3,5-dihydroxyphenyl) 2-phenylacetate is O=C(Cc1ccccc1)Oc1cc(O)cc(O)c1.
What is the InChIKey of (3,5-dihydroxyphenyl) 2-phenylacetate?
The InChIKey is HEDDTPGJYSBDHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O4/c15-11-7-12(16)9-13(8-11)18-14(17)6-10-4-2-1-3-5-10/h1-5,7-9,15-16H,6H2.
What are the key properties of (3,5-dihydroxyphenyl) 2-phenylacetate?
(3,5-dihydroxyphenyl) 2-phenylacetate has a molecular weight of 244.25 g/mol, XLogP of 2.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dihydroxyphenyl) 2-phenylacetate is sourced from PubChem (CID 67711306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).