About 2-[4-(trifluoromethyl)phenyl]-5H-chromeno[3,4-f]quinoline
2-[4-(trifluoromethyl)phenyl]-5H-chromeno[3,4-f]quinoline (PubChem CID 67711475) has the molecular formula C23H14F3NO
and a molecular weight of 377.37 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]-5H-chromeno[3,4-f]quinoline.
Molecular Properties
| Compound Name | 2-[4-(trifluoromethyl)phenyl]-5H-chromeno[3,4-f]quinoline |
| PubChem CID | 67711475 |
| Molecular Formula | C23H14F3NO |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]-5H-chromeno[3,4-f]quinoline |
| SMILES | FC(F)(F)c1ccc(-c2ccc3c4c(ccc3n2)-c2ccccc2OC4)cc1 |
| InChI | InChI=1S/C23H14F3NO/c24-23(25,26)15-7-5-14(6-8-15)20-11-10-17-19-13-28-22-4-2-1-3-18(22)16(19)9-12-21(17)27-20/h1-12H,13H2 |
| InChIKey | NEXAKYUWTNOTFT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-(trifluoromethyl)phenyl]-5H-chromeno[3,4-f]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(trifluoromethyl)phenyl]-5H-chromeno[3,4-f]quinoline?
The IUPAC name of 2-[4-(trifluoromethyl)phenyl]-5H-chromeno[3,4-f]quinoline (CID 67711475) is 2-[4-(trifluoromethyl)phenyl]-5H-chromeno[3,4-f]quinoline.
What is the SMILES notation for 2-[4-(trifluoromethyl)phenyl]-5H-chromeno[3,4-f]quinoline?
The canonical SMILES for 2-[4-(trifluoromethyl)phenyl]-5H-chromeno[3,4-f]quinoline is FC(F)(F)c1ccc(-c2ccc3c4c(ccc3n2)-c2ccccc2OC4)cc1.
What is the InChIKey of 2-[4-(trifluoromethyl)phenyl]-5H-chromeno[3,4-f]quinoline?
The InChIKey is NEXAKYUWTNOTFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14F3NO/c24-23(25,26)15-7-5-14(6-8-15)20-11-10-17-19-13-28-22-4-2-1-3-18(22)16(19)9-12-21(17)27-20/h1-12H,13H2.
What are the key properties of 2-[4-(trifluoromethyl)phenyl]-5H-chromeno[3,4-f]quinoline?
2-[4-(trifluoromethyl)phenyl]-5H-chromeno[3,4-f]quinoline has a molecular weight of 377.37 g/mol, XLogP of 6.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(trifluoromethyl)phenyl]-5H-chromeno[3,4-f]quinoline is sourced from PubChem (CID 67711475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).