C26H32O3S — CID 67712008
ethyl 2-[5-[2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]furan-2-yl]pentanoate (PubChem CID 67712008) has the molecular formula C26H32O3S and a molecular weight of 424.61 g/mol. Its IUPAC name is ethyl 2-[5-[2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]furan-2-yl]pentanoate.
| Compound Name | ethyl 2-[5-[2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]furan-2-yl]pentanoate |
|---|---|
| PubChem CID | 67712008 |
| Molecular Formula | C26H32O3S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | ethyl 2-[5-[2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]furan-2-yl]pentanoate |
| SMILES | CCCC(C(=O)OCC)c1ccc(C#Cc2ccc3c(c2)C(C)(C)CC(C)(C)S3)o1 |
| InChI | InChI=1S/C26H32O3S/c1-7-9-20(24(27)28-8-2)22-14-13-19(29-22)12-10-18-11-15-23-21(16-18)25(3,4)17-26(5,6)30-23/h11,13-16,20H,7-9,17H2,1-6H3 |
| InChIKey | BPBVFSJVPSVBCY-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|