About 4-(10,20-diphenylporphyrin-5-yl)but-3-yn-1-ol
4-(10,20-diphenylporphyrin-5-yl)but-3-yn-1-ol (PubChem CID 67712126) has the molecular formula C36H24N4O
and a molecular weight of 528.62 g/mol. Its IUPAC name is 4-(10,20-diphenylporphyrin-5-yl)but-3-yn-1-ol.
Molecular Properties
| Compound Name | 4-(10,20-diphenylporphyrin-5-yl)but-3-yn-1-ol |
| PubChem CID | 67712126 |
| Molecular Formula | C36H24N4O |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 4-(10,20-diphenylporphyrin-5-yl)but-3-yn-1-ol |
| SMILES | OCCC#C/C1=C2\C=CC(=N2)/C(c2ccccc2)=C2/C=CC(=N2)/C=C2/C=CC(=N2)/C(c2ccccc2)=C2/C=CC1=N2 |
| InChI | InChI=1S/C36H24N4O/c41-22-8-7-13-28-29-18-20-33(39-29)35(24-9-3-1-4-10-24)31-16-14-26(37-31)23-27-15-17-32(38-27)36(25-11-5-2-6-12-25)34-21-19-30(28)40-34/h1-6,9-12,14-21,23,41H,8,22H2/b26-23-,27-23-,29-28-,30-28-,35-31-,35-33-,36-32-,36-34- |
| InChIKey | RVGADVJHGWAUPJ-JSZSPXERSA-N |
| XLogP | 6.39 |
| TPSA | 69.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(10,20-diphenylporphyrin-5-yl)but-3-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(10,20-diphenylporphyrin-5-yl)but-3-yn-1-ol?
The IUPAC name of 4-(10,20-diphenylporphyrin-5-yl)but-3-yn-1-ol (CID 67712126) is 4-(10,20-diphenylporphyrin-5-yl)but-3-yn-1-ol.
What is the SMILES notation for 4-(10,20-diphenylporphyrin-5-yl)but-3-yn-1-ol?
The canonical SMILES for 4-(10,20-diphenylporphyrin-5-yl)but-3-yn-1-ol is OCCC#C/C1=C2\C=CC(=N2)/C(c2ccccc2)=C2/C=CC(=N2)/C=C2/C=CC(=N2)/C(c2ccccc2)=C2/C=CC1=N2.
What is the InChIKey of 4-(10,20-diphenylporphyrin-5-yl)but-3-yn-1-ol?
The InChIKey is RVGADVJHGWAUPJ-JSZSPXERSA-N. The full InChI is InChI=1S/C36H24N4O/c41-22-8-7-13-28-29-18-20-33(39-29)35(24-9-3-1-4-10-24)31-16-14-26(37-31)23-27-15-17-32(38-27)36(25-11-5-2-6-12-25)34-21-19-30(28)40-34/h1-6,9-12,14-21,23,41H,8,22H2/b26-23-,27-23-,29-28-,30-28-,35-31-,35-33-,36-32-,36-34-.
What are the key properties of 4-(10,20-diphenylporphyrin-5-yl)but-3-yn-1-ol?
4-(10,20-diphenylporphyrin-5-yl)but-3-yn-1-ol has a molecular weight of 528.62 g/mol, XLogP of 6.39, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(10,20-diphenylporphyrin-5-yl)but-3-yn-1-ol is sourced from PubChem (CID 67712126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).