About 5-(1-adamantylmethyl)-3-amino-1-(2-hydroxyethyl)-1,5-benzodiazepine-2,4-dione
5-(1-adamantylmethyl)-3-amino-1-(2-hydroxyethyl)-1,5-benzodiazepine-2,4-dione (PubChem CID 67712186) has the molecular formula C22H29N3O3
and a molecular weight of 383.49 g/mol. Its IUPAC name is 5-(1-adamantylmethyl)-3-amino-1-(2-hydroxyethyl)-1,5-benzodiazepine-2,4-dione.
Molecular Properties
| Compound Name | 5-(1-adamantylmethyl)-3-amino-1-(2-hydroxyethyl)-1,5-benzodiazepine-2,4-dione |
| PubChem CID | 67712186 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 5-(1-adamantylmethyl)-3-amino-1-(2-hydroxyethyl)-1,5-benzodiazepine-2,4-dione |
| SMILES | NC1C(=O)N(CCO)c2ccccc2N(CC23CC4CC(CC(C4)C2)C3)C1=O |
| InChI | InChI=1S/C22H29N3O3/c23-19-20(27)24(5-6-26)17-3-1-2-4-18(17)25(21(19)28)13-22-10-14-7-15(11-22)9-16(8-14)12-22/h1-4,14-16,19,26H,5-13,23H2 |
| InChIKey | NPNQHXNMORDHQO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-adamantylmethyl)-3-amino-1-(2-hydroxyethyl)-1,5-benzodiazepine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-adamantylmethyl)-3-amino-1-(2-hydroxyethyl)-1,5-benzodiazepine-2,4-dione?
The IUPAC name of 5-(1-adamantylmethyl)-3-amino-1-(2-hydroxyethyl)-1,5-benzodiazepine-2,4-dione (CID 67712186) is 5-(1-adamantylmethyl)-3-amino-1-(2-hydroxyethyl)-1,5-benzodiazepine-2,4-dione.
What is the SMILES notation for 5-(1-adamantylmethyl)-3-amino-1-(2-hydroxyethyl)-1,5-benzodiazepine-2,4-dione?
The canonical SMILES for 5-(1-adamantylmethyl)-3-amino-1-(2-hydroxyethyl)-1,5-benzodiazepine-2,4-dione is NC1C(=O)N(CCO)c2ccccc2N(CC23CC4CC(CC(C4)C2)C3)C1=O.
What is the InChIKey of 5-(1-adamantylmethyl)-3-amino-1-(2-hydroxyethyl)-1,5-benzodiazepine-2,4-dione?
The InChIKey is NPNQHXNMORDHQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3O3/c23-19-20(27)24(5-6-26)17-3-1-2-4-18(17)25(21(19)28)13-22-10-14-7-15(11-22)9-16(8-14)12-22/h1-4,14-16,19,26H,5-13,23H2.
What are the key properties of 5-(1-adamantylmethyl)-3-amino-1-(2-hydroxyethyl)-1,5-benzodiazepine-2,4-dione?
5-(1-adamantylmethyl)-3-amino-1-(2-hydroxyethyl)-1,5-benzodiazepine-2,4-dione has a molecular weight of 383.49 g/mol, XLogP of 1.90, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-adamantylmethyl)-3-amino-1-(2-hydroxyethyl)-1,5-benzodiazepine-2,4-dione is sourced from PubChem (CID 67712186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).