About (Z)-but-2-enedioic acid;8-methyl-1-oxa-8-azaspiro[4.5]decan-3-amine
(Z)-but-2-enedioic acid;8-methyl-1-oxa-8-azaspiro[4.5]decan-3-amine (PubChem CID 67712534) has the molecular formula C13H22N2O5
and a molecular weight of 286.33 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;8-methyl-1-oxa-8-azaspiro[4.5]decan-3-amine.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;8-methyl-1-oxa-8-azaspiro[4.5]decan-3-amine |
| PubChem CID | 67712534 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | (Z)-but-2-enedioic acid;8-methyl-1-oxa-8-azaspiro[4.5]decan-3-amine |
| SMILES | CN1CCC2(CC1)CC(N)CO2.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C9H18N2O.C4H4O4/c1-11-4-2-9(3-5-11)6-8(10)7-12-9;5-3(6)1-2-4(7)8/h8H,2-7,10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | OWLSOIHVODDILW-BTJKTKAUSA-N |
| XLogP | -0.09 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;8-methyl-1-oxa-8-azaspiro[4.5]decan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;8-methyl-1-oxa-8-azaspiro[4.5]decan-3-amine?
The IUPAC name of (Z)-but-2-enedioic acid;8-methyl-1-oxa-8-azaspiro[4.5]decan-3-amine (CID 67712534) is (Z)-but-2-enedioic acid;8-methyl-1-oxa-8-azaspiro[4.5]decan-3-amine.
What is the SMILES notation for (Z)-but-2-enedioic acid;8-methyl-1-oxa-8-azaspiro[4.5]decan-3-amine?
The canonical SMILES for (Z)-but-2-enedioic acid;8-methyl-1-oxa-8-azaspiro[4.5]decan-3-amine is CN1CCC2(CC1)CC(N)CO2.O=C(O)/C=C\C(=O)O.
What is the InChIKey of (Z)-but-2-enedioic acid;8-methyl-1-oxa-8-azaspiro[4.5]decan-3-amine?
The InChIKey is OWLSOIHVODDILW-BTJKTKAUSA-N. The full InChI is InChI=1S/C9H18N2O.C4H4O4/c1-11-4-2-9(3-5-11)6-8(10)7-12-9;5-3(6)1-2-4(7)8/h8H,2-7,10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-.
What are the key properties of (Z)-but-2-enedioic acid;8-methyl-1-oxa-8-azaspiro[4.5]decan-3-amine?
(Z)-but-2-enedioic acid;8-methyl-1-oxa-8-azaspiro[4.5]decan-3-amine has a molecular weight of 286.33 g/mol, XLogP of -0.09, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;8-methyl-1-oxa-8-azaspiro[4.5]decan-3-amine is sourced from PubChem (CID 67712534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).