About 7-(3,5-diiodooctoxy)xanthen-3-one
7-(3,5-diiodooctoxy)xanthen-3-one (PubChem CID 67712666) has the molecular formula C21H22I2O3
and a molecular weight of 576.21 g/mol. Its IUPAC name is 7-(3,5-diiodooctoxy)xanthen-3-one.
Molecular Properties
| Compound Name | 7-(3,5-diiodooctoxy)xanthen-3-one |
| PubChem CID | 67712666 |
| Molecular Formula | C21H22I2O3 |
| Molecular Weight | 576.21 g/mol |
| Exact Mass | 575.97 |
| IUPAC Name | 7-(3,5-diiodooctoxy)xanthen-3-one |
| SMILES | CCCC(I)CC(I)CCOc1ccc2oc3cc(=O)ccc-3cc2c1 |
| InChI | InChI=1S/C21H22I2O3/c1-2-3-16(22)12-17(23)8-9-25-19-6-7-20-15(11-19)10-14-4-5-18(24)13-21(14)26-20/h4-7,10-11,13,16-17H,2-3,8-9,12H2,1H3 |
| InChIKey | GKFCNZUJQJGGCS-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 576.21 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 7-(3,5-diiodooctoxy)xanthen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,5-diiodooctoxy)xanthen-3-one?
The IUPAC name of 7-(3,5-diiodooctoxy)xanthen-3-one (CID 67712666) is 7-(3,5-diiodooctoxy)xanthen-3-one.
What is the SMILES notation for 7-(3,5-diiodooctoxy)xanthen-3-one?
The canonical SMILES for 7-(3,5-diiodooctoxy)xanthen-3-one is CCCC(I)CC(I)CCOc1ccc2oc3cc(=O)ccc-3cc2c1.
What is the InChIKey of 7-(3,5-diiodooctoxy)xanthen-3-one?
The InChIKey is GKFCNZUJQJGGCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22I2O3/c1-2-3-16(22)12-17(23)8-9-25-19-6-7-20-15(11-19)10-14-4-5-18(24)13-21(14)26-20/h4-7,10-11,13,16-17H,2-3,8-9,12H2,1H3.
What are the key properties of 7-(3,5-diiodooctoxy)xanthen-3-one?
7-(3,5-diiodooctoxy)xanthen-3-one has a molecular weight of 576.21 g/mol, XLogP of 6.46, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,5-diiodooctoxy)xanthen-3-one is sourced from PubChem (CID 67712666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).